C22H39N — CID 166169217
2-[4-(5,5-dimethylhexyl)phenyl]pyrrolidine;2-methylpropane (PubChem CID 166169217) has the molecular formula C22H39N and a molecular weight of 317.56 g/mol. Its IUPAC name is 2-[4-(5,5-dimethylhexyl)phenyl]pyrrolidine;2-methylpropane.
| Compound Name | 2-[4-(5,5-dimethylhexyl)phenyl]pyrrolidine;2-methylpropane |
|---|---|
| PubChem CID | 166169217 |
| Molecular Formula | C22H39N |
| Molecular Weight | 317.56 g/mol |
| Exact Mass | 317.31 |
| IUPAC Name | 2-[4-(5,5-dimethylhexyl)phenyl]pyrrolidine;2-methylpropane |
| SMILES | CC(C)(C)CCCCc1ccc(C2CCCN2)cc1.CC(C)C |
| InChI | InChI=1S/C18H29N.C4H10/c1-18(2,3)13-5-4-7-15-9-11-16(12-10-15)17-8-6-14-19-17;1-4(2)3/h9-12,17,19H,4-8,13-14H2,1-3H3;4H,1-3H3 |
| InChIKey | DUVIPCXDBAMJCG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.56 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|