C27H29ClIN7O — CID 166170812
6-[2-chloro-4-(6-methylpyrazin-2-yl)phenyl]-8-ethyl-2-[2-(1-iodopiperidin-4-yl)ethylamino]pyrido[2,3-d]pyrimidin-7-one (PubChem CID 166170812) has the molecular formula C27H29ClIN7O and a molecular weight of 629.93 g/mol. Its IUPAC name is 6-[2-chloro-4-(6-methylpyrazin-2-yl)phenyl]-8-ethyl-2-[2-(1-iodopiperidin-4-yl)ethylamino]pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 6-[2-chloro-4-(6-methylpyrazin-2-yl)phenyl]-8-ethyl-2-[2-(1-iodopiperidin-4-yl)ethylamino]pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 166170812 |
| Molecular Formula | C27H29ClIN7O |
| Molecular Weight | 629.93 g/mol |
| Exact Mass | 629.12 |
| IUPAC Name | 6-[2-chloro-4-(6-methylpyrazin-2-yl)phenyl]-8-ethyl-2-[2-(1-iodopiperidin-4-yl)ethylamino]pyrido[2,3-d]pyrimidin-7-one |
| SMILES | CCn1c(=O)c(-c2ccc(-c3cncc(C)n3)cc2Cl)cc2cnc(NCCC3CCN(I)CC3)nc21 |
| InChI | InChI=1S/C27H29ClIN7O/c1-3-36-25-20(15-32-27(34-25)31-9-6-18-7-10-35(29)11-8-18)12-22(26(36)37)21-5-4-19(13-23(21)28)24-16-30-14-17(2)33-24/h4-5,12-16,18H,3,6-11H2,1-2H3,(H,31,32,34) |
| InChIKey | BANZVVVDCXPDAR-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 88.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.93 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|