About ethane;2-ethenyliminobut-3-enal
ethane;2-ethenyliminobut-3-enal (PubChem CID 166170950) has the molecular formula C8H13NO
and a molecular weight of 139.20 g/mol. Its IUPAC name is ethane;2-ethenyliminobut-3-enal.
Molecular Properties
| Compound Name | ethane;2-ethenyliminobut-3-enal |
| PubChem CID | 166170950 |
| Molecular Formula | C8H13NO |
| Molecular Weight | 139.20 g/mol |
| Exact Mass | 139.10 |
| IUPAC Name | ethane;2-ethenyliminobut-3-enal |
| SMILES | C=C/N=C(\C=C)C=O.CC |
| InChI | InChI=1S/C6H7NO.C2H6/c1-3-6(5-8)7-4-2;1-2/h3-5H,1-2H2;1-2H3/b7-6+; |
| InChIKey | QFBILYRKSXAADT-UHDJGPCESA-N |
| XLogP | 1.98 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.20 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-ethenyliminobut-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethenyliminobut-3-enal?
The IUPAC name of ethane;2-ethenyliminobut-3-enal (CID 166170950) is ethane;2-ethenyliminobut-3-enal.
What is the SMILES notation for ethane;2-ethenyliminobut-3-enal?
The canonical SMILES for ethane;2-ethenyliminobut-3-enal is C=C/N=C(\C=C)C=O.CC.
What is the InChIKey of ethane;2-ethenyliminobut-3-enal?
The InChIKey is QFBILYRKSXAADT-UHDJGPCESA-N. The full InChI is InChI=1S/C6H7NO.C2H6/c1-3-6(5-8)7-4-2;1-2/h3-5H,1-2H2;1-2H3/b7-6+;.
What are the key properties of ethane;2-ethenyliminobut-3-enal?
ethane;2-ethenyliminobut-3-enal has a molecular weight of 139.20 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethenyliminobut-3-enal is sourced from PubChem (CID 166170950), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).