C27H32N3O3P — CID 166171017
N-[4-[3-(3-dimethylphosphanylphenyl)-2-methoxyanilino]-5-propanoyl-2-pyridinyl]-2-methylpropanamide (PubChem CID 166171017) has the molecular formula C27H32N3O3P and a molecular weight of 477.55 g/mol. Its IUPAC name is N-[4-[3-(3-dimethylphosphanylphenyl)-2-methoxyanilino]-5-propanoyl-2-pyridinyl]-2-methylpropanamide.
| Compound Name | N-[4-[3-(3-dimethylphosphanylphenyl)-2-methoxyanilino]-5-propanoyl-2-pyridinyl]-2-methylpropanamide |
|---|---|
| PubChem CID | 166171017 |
| Molecular Formula | C27H32N3O3P |
| Molecular Weight | 477.55 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-[4-[3-(3-dimethylphosphanylphenyl)-2-methoxyanilino]-5-propanoyl-2-pyridinyl]-2-methylpropanamide |
| SMILES | CCC(=O)c1cnc(NC(=O)C(C)C)cc1Nc1cccc(-c2cccc(P(C)C)c2)c1OC |
| InChI | InChI=1S/C27H32N3O3P/c1-7-24(31)21-16-28-25(30-27(32)17(2)3)15-23(21)29-22-13-9-12-20(26(22)33-4)18-10-8-11-19(14-18)34(5)6/h8-17H,7H2,1-6H3,(H2,28,29,30,32) |
| InChIKey | VQCMDMVQFCMAKG-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.55 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|