C24H6F4O10 — CID 166171269
[4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2,3,5,6-tetrafluorophenyl] 1,3-dioxo-2-benzofuran-5-carboxylate (PubChem CID 166171269) has the molecular formula C24H6F4O10 and a molecular weight of 530.29 g/mol. Its IUPAC name is [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2,3,5,6-tetrafluorophenyl] 1,3-dioxo-2-benzofuran-5-carboxylate.
| Compound Name | [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2,3,5,6-tetrafluorophenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
|---|---|
| PubChem CID | 166171269 |
| Molecular Formula | C24H6F4O10 |
| Molecular Weight | 530.29 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | [4-(1,3-dioxo-2-benzofuran-5-carbonyl)oxy-2,3,5,6-tetrafluorophenyl] 1,3-dioxo-2-benzofuran-5-carboxylate |
| SMILES | O=C(Oc1c(F)c(F)c(OC(=O)c2ccc3c(c2)C(=O)OC3=O)c(F)c1F)c1ccc2c(c1)C(=O)OC2=O |
| InChI | InChI=1S/C24H6F4O10/c25-13-15(27)18(36-20(30)8-2-4-10-12(6-8)24(34)38-22(10)32)16(28)14(26)17(13)35-19(29)7-1-3-9-11(5-7)23(33)37-21(9)31/h1-6H |
| InChIKey | PKMSKLVZVIKTAE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 139.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|