About 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one
5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one (PubChem CID 166172267) has the molecular formula C13H14O2
and a molecular weight of 202.25 g/mol. Its IUPAC name is 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one.
Molecular Properties
| Compound Name | 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one |
| PubChem CID | 166172267 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.10 |
| IUPAC Name | 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one |
| SMILES | O=C1CCCC12CCc1ccc(O)cc12 |
| InChI | InChI=1S/C13H14O2/c14-10-4-3-9-5-7-13(11(9)8-10)6-1-2-12(13)15/h3-4,8,14H,1-2,5-7H2 |
| InChIKey | JKRIIAPMMVPWAW-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one?
The IUPAC name of 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one (CID 166172267) is 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one.
What is the SMILES notation for 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one?
The canonical SMILES for 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one is O=C1CCCC12CCc1ccc(O)cc12.
What is the InChIKey of 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one?
The InChIKey is JKRIIAPMMVPWAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O2/c14-10-4-3-9-5-7-13(11(9)8-10)6-1-2-12(13)15/h3-4,8,14H,1-2,5-7H2.
What are the key properties of 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one?
5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one has a molecular weight of 202.25 g/mol, XLogP of 2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxyspiro[1,2-dihydroindene-3,2'-cyclopentane]-1'-one is sourced from PubChem (CID 166172267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).