C30H36N6O5SSi — CID 166172269
4-cyano-N-[2-[[4-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-4-trimethylsilyloxy-1,3-dihydroisochromene-6-carboxamide (PubChem CID 166172269) has the molecular formula C30H36N6O5SSi and a molecular weight of 620.81 g/mol. Its IUPAC name is 4-cyano-N-[2-[[4-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-4-trimethylsilyloxy-1,3-dihydroisochromene-6-carboxamide.
| Compound Name | 4-cyano-N-[2-[[4-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-4-trimethylsilyloxy-1,3-dihydroisochromene-6-carboxamide |
|---|---|
| PubChem CID | 166172269 |
| Molecular Formula | C30H36N6O5SSi |
| Molecular Weight | 620.81 g/mol |
| Exact Mass | 620.22 |
| IUPAC Name | 4-cyano-N-[2-[[4-[6-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-pyridinyl]-1,3-thiazol-2-yl]amino]-2-oxoethyl]-4-trimethylsilyloxy-1,3-dihydroisochromene-6-carboxamide |
| SMILES | C[C@@H]1CN(c2cccc(-c3csc(NC(=O)CNC(=O)c4ccc5c(c4)C(C#N)(O[Si](C)(C)C)COC5)n3)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C30H36N6O5SSi/c1-19-13-36(14-20(2)40-19)26-8-6-7-24(33-26)25-16-42-29(34-25)35-27(37)12-32-28(38)21-9-10-22-15-39-18-30(17-31,23(22)11-21)41-43(3,4)5/h6-11,16,19-20H,12-15,18H2,1-5H3,(H,32,38)(H,34,35,37)/t19-,20+,30? |
| InChIKey | YWGQCVKUDFCHSF-NWIIZVJYSA-N |
| XLogP | 4.29 |
| TPSA | 138.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.81 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|