C11H17FO5 — CID 166173122
[(1R)-1-[(3aS,5S,6aS)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-fluoroethyl] acetate (PubChem CID 166173122) has the molecular formula C11H17FO5 and a molecular weight of 248.25 g/mol. Its IUPAC name is [(1R)-1-[(3aS,5S,6aS)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-fluoroethyl] acetate.
| Compound Name | [(1R)-1-[(3aS,5S,6aS)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-fluoroethyl] acetate |
|---|---|
| PubChem CID | 166173122 |
| Molecular Formula | C11H17FO5 |
| Molecular Weight | 248.25 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | [(1R)-1-[(3aS,5S,6aS)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2-fluoroethyl] acetate |
| SMILES | CC(=O)O[C@@H](CF)[C@@H]1C[C@@H]2OC(C)(C)O[C@@H]2O1 |
| InChI | InChI=1S/C11H17FO5/c1-6(13)14-9(5-12)7-4-8-10(15-7)17-11(2,3)16-8/h7-10H,4-5H2,1-3H3/t7-,8-,9-,10-/m0/s1 |
| InChIKey | LMQODYMLIIBWNE-XKNYDFJKSA-N |
| XLogP | 1.15 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.25 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |