About 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate
8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate (PubChem CID 166173485) has the molecular formula C22H31NO5
and a molecular weight of 389.49 g/mol. Its IUPAC name is 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate.
Molecular Properties
| Compound Name | 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate |
| PubChem CID | 166173485 |
| Molecular Formula | C22H31NO5 |
| Molecular Weight | 389.49 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate |
| SMILES | CC(C)(C)NC(=O)OCCCCCCCCOc1ccc2ccc(=O)oc2c1 |
| InChI | InChI=1S/C22H31NO5/c1-22(2,3)23-21(25)27-15-9-7-5-4-6-8-14-26-18-12-10-17-11-13-20(24)28-19(17)16-18/h10-13,16H,4-9,14-15H2,1-3H3,(H,23,25) |
| InChIKey | JWANMALFWLQSEH-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 389.49 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate?
The IUPAC name of 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate (CID 166173485) is 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate.
What is the SMILES notation for 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate?
The canonical SMILES for 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate is CC(C)(C)NC(=O)OCCCCCCCCOc1ccc2ccc(=O)oc2c1.
What is the InChIKey of 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate?
The InChIKey is JWANMALFWLQSEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO5/c1-22(2,3)23-21(25)27-15-9-7-5-4-6-8-14-26-18-12-10-17-11-13-20(24)28-19(17)16-18/h10-13,16H,4-9,14-15H2,1-3H3,(H,23,25).
What are the key properties of 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate?
8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate has a molecular weight of 389.49 g/mol, XLogP of 5.04, 10 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2-oxochromen-7-yl)oxyoctyl N-tert-butylcarbamate is sourced from PubChem (CID 166173485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).