About 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine
3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine (PubChem CID 166173759) has the molecular formula C20H18FN3O2
and a molecular weight of 351.38 g/mol. Its IUPAC name is 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine.
Molecular Properties
| Compound Name | 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine |
| PubChem CID | 166173759 |
| Molecular Formula | C20H18FN3O2 |
| Molecular Weight | 351.38 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine |
| SMILES | Fc1ccc2c(n1)OCc1cc(-c3cnn(C4CCCCO4)c3)ccc1-2 |
| InChI | InChI=1S/C20H18FN3O2/c21-18-7-6-17-16-5-4-13(9-14(16)12-26-20(17)23-18)15-10-22-24(11-15)19-3-1-2-8-25-19/h4-7,9-11,19H,1-3,8,12H2 |
| InChIKey | SIPGJNOKQTZGFE-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine?
The IUPAC name of 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine (CID 166173759) is 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine.
What is the SMILES notation for 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine?
The canonical SMILES for 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine is Fc1ccc2c(n1)OCc1cc(-c3cnn(C4CCCCO4)c3)ccc1-2.
What is the InChIKey of 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine?
The InChIKey is SIPGJNOKQTZGFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18FN3O2/c21-18-7-6-17-16-5-4-13(9-14(16)12-26-20(17)23-18)15-10-22-24(11-15)19-3-1-2-8-25-19/h4-7,9-11,19H,1-3,8,12H2.
What are the key properties of 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine?
3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine has a molecular weight of 351.38 g/mol, XLogP of 4.34, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-fluoro-8-[1-(oxan-2-yl)pyrazol-4-yl]-6H-isochromeno[3,4-b]pyridine is sourced from PubChem (CID 166173759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).