C21H20ClN3O2 — CID 166173787
3-chloro-9-[1-(oxan-2-yl)pyrazol-4-yl]-6,7-dihydro-[3]benzoxepino[4,5-b]pyridine (PubChem CID 166173787) has the molecular formula C21H20ClN3O2 and a molecular weight of 381.86 g/mol. Its IUPAC name is 3-chloro-9-[1-(oxan-2-yl)pyrazol-4-yl]-6,7-dihydro-[3]benzoxepino[4,5-b]pyridine.
| Compound Name | 3-chloro-9-[1-(oxan-2-yl)pyrazol-4-yl]-6,7-dihydro-[3]benzoxepino[4,5-b]pyridine |
|---|---|
| PubChem CID | 166173787 |
| Molecular Formula | C21H20ClN3O2 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 3-chloro-9-[1-(oxan-2-yl)pyrazol-4-yl]-6,7-dihydro-[3]benzoxepino[4,5-b]pyridine |
| SMILES | Clc1ccc2c(n1)OCCc1cc(-c3cnn(C4CCCCO4)c3)ccc1-2 |
| InChI | InChI=1S/C21H20ClN3O2/c22-19-7-6-18-17-5-4-14(11-15(17)8-10-27-21(18)24-19)16-12-23-25(13-16)20-3-1-2-9-26-20/h4-7,11-13,20H,1-3,8-10H2 |
| InChIKey | RYPMQELIJJVCOK-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 49.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|