About 3-diethoxyphosphoryl-2,4,6-trimethylpyridine
3-diethoxyphosphoryl-2,4,6-trimethylpyridine (PubChem CID 166174249) has the molecular formula C12H20NO3P
and a molecular weight of 257.27 g/mol. Its IUPAC name is 3-diethoxyphosphoryl-2,4,6-trimethylpyridine.
Molecular Properties
| Compound Name | 3-diethoxyphosphoryl-2,4,6-trimethylpyridine |
| PubChem CID | 166174249 |
| Molecular Formula | C12H20NO3P |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.12 |
| IUPAC Name | 3-diethoxyphosphoryl-2,4,6-trimethylpyridine |
| SMILES | CCOP(=O)(OCC)c1c(C)cc(C)nc1C |
| InChI | InChI=1S/C12H20NO3P/c1-6-15-17(14,16-7-2)12-9(3)8-10(4)13-11(12)5/h8H,6-7H2,1-5H3 |
| InChIKey | SERNXGNQMKCSRX-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-diethoxyphosphoryl-2,4,6-trimethylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-diethoxyphosphoryl-2,4,6-trimethylpyridine?
The IUPAC name of 3-diethoxyphosphoryl-2,4,6-trimethylpyridine (CID 166174249) is 3-diethoxyphosphoryl-2,4,6-trimethylpyridine.
What is the SMILES notation for 3-diethoxyphosphoryl-2,4,6-trimethylpyridine?
The canonical SMILES for 3-diethoxyphosphoryl-2,4,6-trimethylpyridine is CCOP(=O)(OCC)c1c(C)cc(C)nc1C.
What is the InChIKey of 3-diethoxyphosphoryl-2,4,6-trimethylpyridine?
The InChIKey is SERNXGNQMKCSRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20NO3P/c1-6-15-17(14,16-7-2)12-9(3)8-10(4)13-11(12)5/h8H,6-7H2,1-5H3.
What are the key properties of 3-diethoxyphosphoryl-2,4,6-trimethylpyridine?
3-diethoxyphosphoryl-2,4,6-trimethylpyridine has a molecular weight of 257.27 g/mol, XLogP of 2.90, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-diethoxyphosphoryl-2,4,6-trimethylpyridine is sourced from PubChem (CID 166174249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).