C25H24N2O3 — CID 166174291
4-[(E)-3-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)-2-[(E)-2-phenylethenyl]hept-1-enyl]benzonitrile (PubChem CID 166174291) has the molecular formula C25H24N2O3 and a molecular weight of 400.48 g/mol. Its IUPAC name is 4-[(E)-3-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)-2-[(E)-2-phenylethenyl]hept-1-enyl]benzonitrile.
| Compound Name | 4-[(E)-3-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)-2-[(E)-2-phenylethenyl]hept-1-enyl]benzonitrile |
|---|---|
| PubChem CID | 166174291 |
| Molecular Formula | C25H24N2O3 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 4-[(E)-3-oxo-1-(2-oxo-1,3-oxazolidin-3-yl)-2-[(E)-2-phenylethenyl]hept-1-enyl]benzonitrile |
| SMILES | CCCCC(=O)C(/C=C/c1ccccc1)=C(\c1ccc(C#N)cc1)N1CCOC1=O |
| InChI | InChI=1S/C25H24N2O3/c1-2-3-9-23(28)22(15-12-19-7-5-4-6-8-19)24(27-16-17-30-25(27)29)21-13-10-20(18-26)11-14-21/h4-8,10-15H,2-3,9,16-17H2,1H3/b15-12+,24-22+ |
| InChIKey | PMBGHMHGYSSANG-GRXRNDOGSA-N |
| XLogP | 5.19 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|