C16H19FO2 — CID 166174323
6-fluoro-1-[(1R,8S,9S)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]hexan-1-one (PubChem CID 166174323) has the molecular formula C16H19FO2 and a molecular weight of 262.32 g/mol. Its IUPAC name is 6-fluoro-1-[(1R,8S,9S)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]hexan-1-one.
| Compound Name | 6-fluoro-1-[(1R,8S,9S)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]hexan-1-one |
|---|---|
| PubChem CID | 166174323 |
| Molecular Formula | C16H19FO2 |
| Molecular Weight | 262.32 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 6-fluoro-1-[(1R,8S,9S)-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6-trien-9-yl]hexan-1-one |
| SMILES | O=C(CCCCCF)[C@H]1C[C@H]2O[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C16H19FO2/c17-9-5-1-2-8-14(18)13-10-15-11-6-3-4-7-12(11)16(13)19-15/h3-4,6-7,13,15-16H,1-2,5,8-10H2/t13-,15-,16-/m1/s1 |
| InChIKey | RZVAFCHUFZVEPK-FVQBIDKESA-N |
| XLogP | 3.92 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.32 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|