C12H16O2 — CID 166175005
2,3,4a,5,6,6a,7,8-octahydrobenzo[h][1,4]benzodioxine (PubChem CID 166175005) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2,3,4a,5,6,6a,7,8-octahydrobenzo[h][1,4]benzodioxine.
| Compound Name | 2,3,4a,5,6,6a,7,8-octahydrobenzo[h][1,4]benzodioxine |
|---|---|
| PubChem CID | 166175005 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2,3,4a,5,6,6a,7,8-octahydrobenzo[h][1,4]benzodioxine |
| SMILES | C1=CC2=C3OCCOC3CCC2CC1 |
| InChI | InChI=1S/C12H16O2/c1-2-4-10-9(3-1)5-6-11-12(10)14-8-7-13-11/h2,4,9,11H,1,3,5-8H2 |
| InChIKey | IECOHGQBEQNPOK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |