About 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol
2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol (PubChem CID 166175485) has the molecular formula C9H17F3N2O
and a molecular weight of 226.24 g/mol. Its IUPAC name is 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol.
Molecular Properties
| Compound Name | 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol |
| PubChem CID | 166175485 |
| Molecular Formula | C9H17F3N2O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol |
| SMILES | C[C@@H]1CN(CC(F)(F)F)CCN1CCO |
| InChI | InChI=1S/C9H17F3N2O/c1-8-6-13(7-9(10,11)12)2-3-14(8)4-5-15/h8,15H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | LFVADECUQGJWKA-MRVPVSSYSA-N |
| XLogP | 0.55 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol?
The IUPAC name of 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol (CID 166175485) is 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol.
What is the SMILES notation for 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol?
The canonical SMILES for 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol is C[C@@H]1CN(CC(F)(F)F)CCN1CCO.
What is the InChIKey of 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol?
The InChIKey is LFVADECUQGJWKA-MRVPVSSYSA-N. The full InChI is InChI=1S/C9H17F3N2O/c1-8-6-13(7-9(10,11)12)2-3-14(8)4-5-15/h8,15H,2-7H2,1H3/t8-/m1/s1.
What are the key properties of 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol?
2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol has a molecular weight of 226.24 g/mol, XLogP of 0.55, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2R)-2-methyl-4-(2,2,2-trifluoroethyl)piperazin-1-yl]ethanol is sourced from PubChem (CID 166175485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).