C22H26N6O — CID 166176056
4-(aminomethyl)-6-(5-isoquinolin-8-yl-1-methylpyrazol-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one (PubChem CID 166176056) has the molecular formula C22H26N6O and a molecular weight of 390.49 g/mol. Its IUPAC name is 4-(aminomethyl)-6-(5-isoquinolin-8-yl-1-methylpyrazol-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one.
| Compound Name | 4-(aminomethyl)-6-(5-isoquinolin-8-yl-1-methylpyrazol-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
|---|---|
| PubChem CID | 166176056 |
| Molecular Formula | C22H26N6O |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | 4-(aminomethyl)-6-(5-isoquinolin-8-yl-1-methylpyrazol-4-yl)-3,4,4a,5,6,7,8,8a-octahydro-2H-phthalazin-1-one |
| SMILES | Cn1ncc(C2CCC3C(=O)NNC(CN)C3C2)c1-c1cccc2ccncc12 |
| InChI | InChI=1S/C22H26N6O/c1-28-21(15-4-2-3-13-7-8-24-11-18(13)15)19(12-25-28)14-5-6-16-17(9-14)20(10-23)26-27-22(16)29/h2-4,7-8,11-12,14,16-17,20,26H,5-6,9-10,23H2,1H3,(H,27,29) |
| InChIKey | ZATJMJIPMXWKFB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |