C23H16F3N3O3 — CID 166176815
2-[[1-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carbonyl]amino]benzoic acid (PubChem CID 166176815) has the molecular formula C23H16F3N3O3 and a molecular weight of 439.39 g/mol. Its IUPAC name is 2-[[1-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carbonyl]amino]benzoic acid.
| Compound Name | 2-[[1-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carbonyl]amino]benzoic acid |
|---|---|
| PubChem CID | 166176815 |
| Molecular Formula | C23H16F3N3O3 |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 439.11 |
| IUPAC Name | 2-[[1-[[4-(trifluoromethyl)phenyl]methyl]indazole-3-carbonyl]amino]benzoic acid |
| SMILES | O=C(O)c1ccccc1NC(=O)c1nn(Cc2ccc(C(F)(F)F)cc2)c2ccccc12 |
| InChI | InChI=1S/C23H16F3N3O3/c24-23(25,26)15-11-9-14(10-12-15)13-29-19-8-4-2-6-17(19)20(28-29)21(30)27-18-7-3-1-5-16(18)22(31)32/h1-12H,13H2,(H,27,30)(H,31,32) |
| InChIKey | YSYDGKGNFZTTDE-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |