C28H28BrNO4 — CID 166176983
2,3,10-trimethoxy-9-[(3-methylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide (PubChem CID 166176983) has the molecular formula C28H28BrNO4 and a molecular weight of 522.44 g/mol. Its IUPAC name is 2,3,10-trimethoxy-9-[(3-methylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide.
| Compound Name | 2,3,10-trimethoxy-9-[(3-methylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide |
|---|---|
| PubChem CID | 166176983 |
| Molecular Formula | C28H28BrNO4 |
| Molecular Weight | 522.44 g/mol |
| Exact Mass | 521.12 |
| IUPAC Name | 2,3,10-trimethoxy-9-[(3-methylphenyl)methoxy]-5,6-dihydroisoquinolino[2,1-b]isoquinolin-7-ium bromide |
| SMILES | COc1cc2c(cc1OC)-c1cc3ccc(OC)c(OCc4cccc(C)c4)c3c[n+]1CC2.[Br-] |
| InChI | InChI=1S/C28H28NO4.BrH/c1-18-6-5-7-19(12-18)17-33-28-23-16-29-11-10-21-14-26(31-3)27(32-4)15-22(21)24(29)13-20(23)8-9-25(28)30-2;/h5-9,12-16H,10-11,17H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ZJDFWYFAYRTEHX-UHFFFAOYSA-M |
| XLogP | 2.27 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|