C25H40O6SSi — CID 166177081
(2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(1R,2R)-1-hydroxy-1,2-dihydronaphthalen-2-yl]oxy]-6-propan-2-ylsulfanyloxane-3,5-diol (PubChem CID 166177081) has the molecular formula C25H40O6SSi and a molecular weight of 496.74 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(1R,2R)-1-hydroxy-1,2-dihydronaphthalen-2-yl]oxy]-6-propan-2-ylsulfanyloxane-3,5-diol.
| Compound Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(1R,2R)-1-hydroxy-1,2-dihydronaphthalen-2-yl]oxy]-6-propan-2-ylsulfanyloxane-3,5-diol |
|---|---|
| PubChem CID | 166177081 |
| Molecular Formula | C25H40O6SSi |
| Molecular Weight | 496.74 g/mol |
| Exact Mass | 496.23 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-[[(1R,2R)-1-hydroxy-1,2-dihydronaphthalen-2-yl]oxy]-6-propan-2-ylsulfanyloxane-3,5-diol |
| SMILES | CC(C)S[C@@H]1O[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O)[C@H](O[C@@H]2C=Cc3ccccc3[C@H]2O)[C@H]1O |
| InChI | InChI=1S/C25H40O6SSi/c1-15(2)32-24-22(28)23(21(27)19(31-24)14-29-33(6,7)25(3,4)5)30-18-13-12-16-10-8-9-11-17(16)20(18)26/h8-13,15,18-24,26-28H,14H2,1-7H3/t18-,19-,20-,21+,22-,23+,24+/m1/s1 |
| InChIKey | BWXSCFMRMSPQCV-CRJLIHAFSA-N |
| XLogP | 4.11 |
| TPSA | 88.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.74 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|