C17H34O6Si — CID 166177093
(2R,3S,4S,5S,6S)-5-[(2R)-but-3-en-2-yl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxyoxane-3,4-diol (PubChem CID 166177093) has the molecular formula C17H34O6Si and a molecular weight of 362.54 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-5-[(2R)-but-3-en-2-yl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3S,4S,5S,6S)-5-[(2R)-but-3-en-2-yl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 166177093 |
| Molecular Formula | C17H34O6Si |
| Molecular Weight | 362.54 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | (2R,3S,4S,5S,6S)-5-[(2R)-but-3-en-2-yl]oxy-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-6-methoxyoxane-3,4-diol |
| SMILES | C=C[C@@H](C)O[C@@H]1[C@@H](OC)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C17H34O6Si/c1-9-11(2)22-15-14(19)13(18)12(23-16(15)20-6)10-21-24(7,8)17(3,4)5/h9,11-16,18-19H,1,10H2,2-8H3/t11-,12-,13-,14+,15+,16+/m1/s1 |
| InChIKey | SYDODHPUGGUPDI-ODICJLLRSA-N |
| XLogP | 2.06 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.54 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|