C22H42O6Si — CID 166177094
(2R,3S,4S,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1S)-1-cyclohexylprop-2-enoxy]-6-methoxyoxane-3,4-diol (PubChem CID 166177094) has the molecular formula C22H42O6Si and a molecular weight of 430.66 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1S)-1-cyclohexylprop-2-enoxy]-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3S,4S,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1S)-1-cyclohexylprop-2-enoxy]-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 166177094 |
| Molecular Formula | C22H42O6Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(1S)-1-cyclohexylprop-2-enoxy]-6-methoxyoxane-3,4-diol |
| SMILES | C=C[C@H](O[C@@H]1[C@@H](OC)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O)C1CCCCC1 |
| InChI | InChI=1S/C22H42O6Si/c1-8-16(15-12-10-9-11-13-15)27-20-19(24)18(23)17(28-21(20)25-5)14-26-29(6,7)22(2,3)4/h8,15-21,23-24H,1,9-14H2,2-7H3/t16-,17+,18+,19-,20-,21-/m0/s1 |
| InChIKey | DWKFLAKHTIRTBR-XUDSTZEESA-N |
| XLogP | 3.62 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|