C19H38O6Si — CID 166177095
(2R,3S,4S,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(3R)-hex-1-en-3-yl]oxy-6-methoxyoxane-3,4-diol (PubChem CID 166177095) has the molecular formula C19H38O6Si and a molecular weight of 390.59 g/mol. Its IUPAC name is (2R,3S,4S,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(3R)-hex-1-en-3-yl]oxy-6-methoxyoxane-3,4-diol.
| Compound Name | (2R,3S,4S,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(3R)-hex-1-en-3-yl]oxy-6-methoxyoxane-3,4-diol |
|---|---|
| PubChem CID | 166177095 |
| Molecular Formula | C19H38O6Si |
| Molecular Weight | 390.59 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | (2R,3S,4S,5S,6S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-[(3R)-hex-1-en-3-yl]oxy-6-methoxyoxane-3,4-diol |
| SMILES | C=C[C@@H](CCC)O[C@@H]1[C@@H](OC)O[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C19H38O6Si/c1-9-11-13(10-2)24-17-16(21)15(20)14(25-18(17)22-6)12-23-26(7,8)19(3,4)5/h10,13-18,20-21H,2,9,11-12H2,1,3-8H3/t13-,14+,15+,16-,17-,18-/m0/s1 |
| InChIKey | BJYNRJTUOHJNML-IZPLOLCNSA-N |
| XLogP | 2.84 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.59 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|