C30H56 — CID 166177199
(3S,3aS,5aS,9aS,9bS)-3-[(6R)-6,10-dimethylundecan-2-yl]-3a,6,6,9a-tetramethyl-1,2,3,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene (PubChem CID 166177199) has the molecular formula C30H56 and a molecular weight of 416.78 g/mol. Its IUPAC name is (3S,3aS,5aS,9aS,9bS)-3-[(6R)-6,10-dimethylundecan-2-yl]-3a,6,6,9a-tetramethyl-1,2,3,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene.
| Compound Name | (3S,3aS,5aS,9aS,9bS)-3-[(6R)-6,10-dimethylundecan-2-yl]-3a,6,6,9a-tetramethyl-1,2,3,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene |
|---|---|
| PubChem CID | 166177199 |
| Molecular Formula | C30H56 |
| Molecular Weight | 416.78 g/mol |
| Exact Mass | 416.44 |
| IUPAC Name | (3S,3aS,5aS,9aS,9bS)-3-[(6R)-6,10-dimethylundecan-2-yl]-3a,6,6,9a-tetramethyl-1,2,3,4,5,5a,7,8,9,9b-decahydrocyclopenta[a]naphthalene |
| SMILES | CC(C)CCC[C@@H](C)CCCC(C)[C@@H]1CC[C@H]2[C@@]1(C)CC[C@H]1C(C)(C)CCC[C@]21C |
| InChI | InChI=1S/C30H56/c1-22(2)12-9-13-23(3)14-10-15-24(4)25-16-17-27-29(25,7)21-18-26-28(5,6)19-11-20-30(26,27)8/h22-27H,9-21H2,1-8H3/t23-,24?,25+,26+,27+,29+,30+/m1/s1 |
| InChIKey | SGHXJVFMQPUFPZ-NEIJHQMESA-N |
| XLogP | 9.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.78 |
| LogP ≤ 5 | 9.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |