C26H24N4O4 — CID 16617730
[1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate (PubChem CID 16617730) has the molecular formula C26H24N4O4 and a molecular weight of 456.50 g/mol. Its IUPAC name is [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate.
| Compound Name | [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate |
|---|---|
| PubChem CID | 16617730 |
| Molecular Formula | C26H24N4O4 |
| Molecular Weight | 456.50 g/mol |
| Exact Mass | 456.18 |
| IUPAC Name | [1-[(1,5-dimethyl-3-oxo-2-phenylpyrazol-4-yl)amino]-1-oxopropan-2-yl] (E)-3-quinolin-8-ylprop-2-enoate |
| SMILES | Cc1c(NC(=O)C(C)OC(=O)/C=C/c2cccc3cccnc23)c(=O)n(-c2ccccc2)n1C |
| InChI | InChI=1S/C26H24N4O4/c1-17-23(26(33)30(29(17)3)21-12-5-4-6-13-21)28-25(32)18(2)34-22(31)15-14-20-10-7-9-19-11-8-16-27-24(19)20/h4-16,18H,1-3H3,(H,28,32)/b15-14+ |
| InChIKey | UQPQSXRMRAGRAK-CCEZHUSRSA-N |
| XLogP | 3.62 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|