C30H30ClF2N7O — CID 166177447
7-(5-chloroisoquinolin-4-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidine (PubChem CID 166177447) has the molecular formula C30H30ClF2N7O and a molecular weight of 578.07 g/mol. Its IUPAC name is 7-(5-chloroisoquinolin-4-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidine.
| Compound Name | 7-(5-chloroisoquinolin-4-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 166177447 |
| Molecular Formula | C30H30ClF2N7O |
| Molecular Weight | 578.07 g/mol |
| Exact Mass | 577.22 |
| IUPAC Name | 7-(5-chloroisoquinolin-4-yl)-4-(3,8-diazabicyclo[3.2.1]octan-3-yl)-8-fluoro-2-[[(2S)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methoxy]pyrido[4,3-d]pyrimidine |
| SMILES | Fc1c(-c2cncc3cccc(Cl)c23)ncc2c(N3CC4CCC(C3)N4)nc(OCC34CCCN3C[C@@H](F)C4)nc12 |
| InChI | InChI=1S/C30H30ClF2N7O/c31-23-4-1-3-17-10-34-11-21(24(17)23)26-25(33)27-22(12-35-26)28(39-14-19-5-6-20(15-39)36-19)38-29(37-27)41-16-30-7-2-8-40(30)13-18(32)9-30/h1,3-4,10-12,18-20,36H,2,5-9,13-16H2/t18-,19?,20?,30?/m0/s1 |
| InChIKey | ATQQMDKVIRVNSQ-MDASKKHBSA-N |
| XLogP | 4.93 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.07 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |