C26H37N9OS — CID 166177856
3-methyl-4-N-[4-[(1R,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]cyclohexyl]-6-N-[1-(oxan-4-yl)pyrazol-4-yl]-[1,2]thiazolo[5,4-d]pyrimidine-4,6-diamine (PubChem CID 166177856) has the molecular formula C26H37N9OS and a molecular weight of 523.71 g/mol. Its IUPAC name is 3-methyl-4-N-[4-[(1R,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]cyclohexyl]-6-N-[1-(oxan-4-yl)pyrazol-4-yl]-[1,2]thiazolo[5,4-d]pyrimidine-4,6-diamine.
| Compound Name | 3-methyl-4-N-[4-[(1R,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]cyclohexyl]-6-N-[1-(oxan-4-yl)pyrazol-4-yl]-[1,2]thiazolo[5,4-d]pyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 166177856 |
| Molecular Formula | C26H37N9OS |
| Molecular Weight | 523.71 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 3-methyl-4-N-[4-[(1R,4R)-5-methyl-2,5-diazabicyclo[2.2.1]heptan-2-yl]cyclohexyl]-6-N-[1-(oxan-4-yl)pyrazol-4-yl]-[1,2]thiazolo[5,4-d]pyrimidine-4,6-diamine |
| SMILES | Cc1nsc2nc(Nc3cnn(C4CCOCC4)c3)nc(NC3CCC(N4C[C@H]5C[C@@H]4CN5C)CC3)c12 |
| InChI | InChI=1S/C26H37N9OS/c1-16-23-24(28-17-3-5-19(6-4-17)34-15-21-11-22(34)14-33(21)2)30-26(31-25(23)37-32-16)29-18-12-27-35(13-18)20-7-9-36-10-8-20/h12-13,17,19-22H,3-11,14-15H2,1-2H3,(H2,28,29,30,31)/t17?,19?,21-,22-/m1/s1 |
| InChIKey | DAURBICZFHPRGX-NPTZKERSSA-N |
| XLogP | 3.80 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.71 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |