C22H24ClN5O — CID 166177882
4-[1-[(4-chlorophenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-methyl-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 166177882) has the molecular formula C22H24ClN5O and a molecular weight of 409.92 g/mol. Its IUPAC name is 4-[1-[(4-chlorophenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-methyl-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[1-[(4-chlorophenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-methyl-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 166177882 |
| Molecular Formula | C22H24ClN5O |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | 4-[1-[(4-chlorophenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-methyl-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cc1nc2ncc(C3CN(C)C(=O)C4NCCC43)cc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H24ClN5O/c1-13-26-21-19(28(13)11-14-3-5-16(23)6-4-14)9-15(10-25-21)18-12-27(2)22(29)20-17(18)7-8-24-20/h3-6,9-10,17-18,20,24H,7-8,11-12H2,1-2H3 |
| InChIKey | PKOOUVHYFQNQFG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |