C23H27N5O2 — CID 166177883
4-[1-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-methyl-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 166177883) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-[1-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-methyl-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[1-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-methyl-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 166177883 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 4-[1-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-methyl-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | COc1ccc(Cn2c(C)nc3ncc(C4CN(C)C(=O)C5NCCC54)cc32)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-14-26-22-20(28(14)12-15-4-6-17(30-3)7-5-15)10-16(11-25-22)19-13-27(2)23(29)21-18(19)8-9-24-21/h4-7,10-11,18-19,21,24H,8-9,12-13H2,1-3H3 |
| InChIKey | TXOIOQDMWCQSAX-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |