C24H27N5O3 — CID 166177890
methyl 4-[[2-methyl-6-(6-methyl-7-oxo-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-4-yl)imidazo[4,5-b]pyridin-1-yl]methyl]benzoate (PubChem CID 166177890) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is methyl 4-[[2-methyl-6-(6-methyl-7-oxo-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-4-yl)imidazo[4,5-b]pyridin-1-yl]methyl]benzoate.
| Compound Name | methyl 4-[[2-methyl-6-(6-methyl-7-oxo-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-4-yl)imidazo[4,5-b]pyridin-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 166177890 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | methyl 4-[[2-methyl-6-(6-methyl-7-oxo-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-4-yl)imidazo[4,5-b]pyridin-1-yl]methyl]benzoate |
| SMILES | COC(=O)c1ccc(Cn2c(C)nc3ncc(C4CN(C)C(=O)C5NCCC54)cc32)cc1 |
| InChI | InChI=1S/C24H27N5O3/c1-14-27-22-20(29(14)12-15-4-6-16(7-5-15)24(31)32-3)10-17(11-26-22)19-13-28(2)23(30)21-18(19)8-9-25-21/h4-7,10-11,18-19,21,25H,8-9,12-13H2,1-3H3 |
| InChIKey | FHKITHYIDRCGLM-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |