C23H27N5O2 — CID 166177891
4-[1-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-2-methyl-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-c]pyridin-7-one (PubChem CID 166177891) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 4-[1-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-2-methyl-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[1-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-2-methyl-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 166177891 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 4-[1-[(4-methoxyphenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-2-methyl-1,2,3,3a,4,5,6,7a-octahydropyrrolo[2,3-c]pyridin-7-one |
| SMILES | COc1ccc(Cn2c(C)nc3ncc(C4CNC(=O)C5NC(C)CC54)cc32)cc1 |
| InChI | InChI=1S/C23H27N5O2/c1-13-8-18-19(11-25-23(29)21(18)26-13)16-9-20-22(24-10-16)27-14(2)28(20)12-15-4-6-17(30-3)7-5-15/h4-7,9-10,13,18-19,21,26H,8,11-12H2,1-3H3,(H,25,29) |
| InChIKey | XJFHBUDQWZHRGI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 81.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |