C27H27ClN6O — CID 166177893
4-[1-[(4-chlorophenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-(pyridin-3-ylmethyl)-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one (PubChem CID 166177893) has the molecular formula C27H27ClN6O and a molecular weight of 487.01 g/mol. Its IUPAC name is 4-[1-[(4-chlorophenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-(pyridin-3-ylmethyl)-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one.
| Compound Name | 4-[1-[(4-chlorophenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-(pyridin-3-ylmethyl)-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one |
|---|---|
| PubChem CID | 166177893 |
| Molecular Formula | C27H27ClN6O |
| Molecular Weight | 487.01 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | 4-[1-[(4-chlorophenyl)methyl]-2-methylimidazo[4,5-b]pyridin-6-yl]-6-(pyridin-3-ylmethyl)-2,3,3a,4,5,7a-hexahydro-1H-pyrrolo[2,3-c]pyridin-7-one |
| SMILES | Cc1nc2ncc(C3CN(Cc4cccnc4)C(=O)C4NCCC43)cc2n1Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C27H27ClN6O/c1-17-32-26-24(34(17)15-18-4-6-21(28)7-5-18)11-20(13-31-26)23-16-33(14-19-3-2-9-29-12-19)27(35)25-22(23)8-10-30-25/h2-7,9,11-13,22-23,25,30H,8,10,14-16H2,1H3 |
| InChIKey | IIWPZLYGZIECMN-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.01 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |