C30H30N2O4 — CID 166177970
(2R)-2-[(8E,17S)-2-oxo-12-oxa-1,14-diazapentacyclo[16.5.3.23,6.213,16.021,25]triaconta-3(30),4,6(29),8,13,15,18(26),19,21(25),27-decaen-17-yl]propanoic acid (PubChem CID 166177970) has the molecular formula C30H30N2O4 and a molecular weight of 482.58 g/mol. Its IUPAC name is (2R)-2-[(8E,17S)-2-oxo-12-oxa-1,14-diazapentacyclo[16.5.3.23,6.213,16.021,25]triaconta-3(30),4,6(29),8,13,15,18(26),19,21(25),27-decaen-17-yl]propanoic acid.
| Compound Name | (2R)-2-[(8E,17S)-2-oxo-12-oxa-1,14-diazapentacyclo[16.5.3.23,6.213,16.021,25]triaconta-3(30),4,6(29),8,13,15,18(26),19,21(25),27-decaen-17-yl]propanoic acid |
|---|---|
| PubChem CID | 166177970 |
| Molecular Formula | C30H30N2O4 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.22 |
| IUPAC Name | (2R)-2-[(8E,17S)-2-oxo-12-oxa-1,14-diazapentacyclo[16.5.3.23,6.213,16.021,25]triaconta-3(30),4,6(29),8,13,15,18(26),19,21(25),27-decaen-17-yl]propanoic acid |
| SMILES | C[C@@H](C(=O)O)[C@@H]1c2ccc(nc2)OCC/C=C/Cc2ccc(cc2)C(=O)N2CCc3ccc1cc3C2 |
| InChI | InChI=1S/C30H30N2O4/c1-20(30(34)35)28-24-11-10-22-14-15-32(19-26(22)17-24)29(33)23-8-6-21(7-9-23)5-3-2-4-16-36-27-13-12-25(28)18-31-27/h2-3,6-13,17-18,20,28H,4-5,14-16,19H2,1H3,(H,34,35)/b3-2+/t20-,28+/m1/s1 |
| InChIKey | GJLAVSDHBUDAFE-IDLWRVDWSA-N |
| XLogP | 5.01 |
| TPSA | 79.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|