C21H26N6O5 — CID 166178025
[1-[4-(2-methoxyethoxy)-6-[(3R)-3-methoxyoxolan-3-yl]-2-pyridinyl]-3-methylpyrazolo[4,3-c]pyridin-6-yl]urea (PubChem CID 166178025) has the molecular formula C21H26N6O5 and a molecular weight of 442.48 g/mol. Its IUPAC name is [1-[4-(2-methoxyethoxy)-6-[(3R)-3-methoxyoxolan-3-yl]-2-pyridinyl]-3-methylpyrazolo[4,3-c]pyridin-6-yl]urea.
| Compound Name | [1-[4-(2-methoxyethoxy)-6-[(3R)-3-methoxyoxolan-3-yl]-2-pyridinyl]-3-methylpyrazolo[4,3-c]pyridin-6-yl]urea |
|---|---|
| PubChem CID | 166178025 |
| Molecular Formula | C21H26N6O5 |
| Molecular Weight | 442.48 g/mol |
| Exact Mass | 442.20 |
| IUPAC Name | [1-[4-(2-methoxyethoxy)-6-[(3R)-3-methoxyoxolan-3-yl]-2-pyridinyl]-3-methylpyrazolo[4,3-c]pyridin-6-yl]urea |
| SMILES | COCCOc1cc(-n2nc(C)c3cnc(NC(N)=O)cc32)nc([C@]2(OC)CCOC2)c1 |
| InChI | InChI=1S/C21H26N6O5/c1-13-15-11-23-18(25-20(22)28)10-16(15)27(26-13)19-9-14(32-7-6-29-2)8-17(24-19)21(30-3)4-5-31-12-21/h8-11H,4-7,12H2,1-3H3,(H3,22,23,25,28)/t21-/m0/s1 |
| InChIKey | ZITPGMGHRIFONJ-NRFANRHFSA-N |
| XLogP | 1.90 |
| TPSA | 135.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.48 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|