C14H15N7O3 — CID 166179775
N-[2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-1-oxidopyridin-1-ium-4-carboxamide (PubChem CID 166179775) has the molecular formula C14H15N7O3 and a molecular weight of 329.32 g/mol. Its IUPAC name is N-[2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-1-oxidopyridin-1-ium-4-carboxamide.
| Compound Name | N-[2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-1-oxidopyridin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 166179775 |
| Molecular Formula | C14H15N7O3 |
| Molecular Weight | 329.32 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | N-[2-methyl-1-[3-(1H-1,2,4-triazol-5-yl)-1,2,4-oxadiazol-5-yl]propyl]-1-oxidopyridin-1-ium-4-carboxamide |
| SMILES | CC(C)C(NC(=O)c1cc[n+]([O-])cc1)c1nc(-c2ncn[nH]2)no1 |
| InChI | InChI=1S/C14H15N7O3/c1-8(2)10(17-13(22)9-3-5-21(23)6-4-9)14-18-12(20-24-14)11-15-7-16-19-11/h3-8,10H,1-2H3,(H,17,22)(H,15,16,19) |
| InChIKey | VYCIXPIGJHSIIW-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 136.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.32 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|