About (5-cyano-2-pyridinyl)methyl 4-oxopentanoate
(5-cyano-2-pyridinyl)methyl 4-oxopentanoate (PubChem CID 166180049) has the molecular formula C12H12N2O3
and a molecular weight of 232.24 g/mol. Its IUPAC name is (5-cyano-2-pyridinyl)methyl 4-oxopentanoate.
Molecular Properties
| Compound Name | (5-cyano-2-pyridinyl)methyl 4-oxopentanoate |
| PubChem CID | 166180049 |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | (5-cyano-2-pyridinyl)methyl 4-oxopentanoate |
| SMILES | CC(=O)CCC(=O)OCc1ccc(C#N)cn1 |
| InChI | InChI=1S/C12H12N2O3/c1-9(15)2-5-12(16)17-8-11-4-3-10(6-13)7-14-11/h3-4,7H,2,5,8H2,1H3 |
| InChIKey | MHDQMPQYIQZKAB-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (5-cyano-2-pyridinyl)methyl 4-oxopentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-cyano-2-pyridinyl)methyl 4-oxopentanoate?
The IUPAC name of (5-cyano-2-pyridinyl)methyl 4-oxopentanoate (CID 166180049) is (5-cyano-2-pyridinyl)methyl 4-oxopentanoate.
What is the SMILES notation for (5-cyano-2-pyridinyl)methyl 4-oxopentanoate?
The canonical SMILES for (5-cyano-2-pyridinyl)methyl 4-oxopentanoate is CC(=O)CCC(=O)OCc1ccc(C#N)cn1.
What is the InChIKey of (5-cyano-2-pyridinyl)methyl 4-oxopentanoate?
The InChIKey is MHDQMPQYIQZKAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O3/c1-9(15)2-5-12(16)17-8-11-4-3-10(6-13)7-14-11/h3-4,7H,2,5,8H2,1H3.
What are the key properties of (5-cyano-2-pyridinyl)methyl 4-oxopentanoate?
(5-cyano-2-pyridinyl)methyl 4-oxopentanoate has a molecular weight of 232.24 g/mol, XLogP of 1.37, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5-cyano-2-pyridinyl)methyl 4-oxopentanoate is sourced from PubChem (CID 166180049), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).