C27H25N3O3 — CID 166180625
3-[(1-benzoylpiperidin-4-yl)methyl]-6-phenyl-1H-quinazoline-2,4-dione (PubChem CID 166180625) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 3-[(1-benzoylpiperidin-4-yl)methyl]-6-phenyl-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(1-benzoylpiperidin-4-yl)methyl]-6-phenyl-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 166180625 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 3-[(1-benzoylpiperidin-4-yl)methyl]-6-phenyl-1H-quinazoline-2,4-dione |
| SMILES | O=C(c1ccccc1)N1CCC(Cn2c(=O)[nH]c3ccc(-c4ccccc4)cc3c2=O)CC1 |
| InChI | InChI=1S/C27H25N3O3/c31-25(21-9-5-2-6-10-21)29-15-13-19(14-16-29)18-30-26(32)23-17-22(20-7-3-1-4-8-20)11-12-24(23)28-27(30)33/h1-12,17,19H,13-16,18H2,(H,28,33) |
| InChIKey | ICYRZBXTJAJQTF-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |