About 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one
6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one (PubChem CID 166181776) has the molecular formula C26H20N2O3S
and a molecular weight of 440.52 g/mol. Its IUPAC name is 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one.
Molecular Properties
| Compound Name | 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one |
| PubChem CID | 166181776 |
| Molecular Formula | C26H20N2O3S |
| Molecular Weight | 440.52 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one |
| SMILES | CN1C(=O)c2cccc3c(S(=O)(=O)N4Cc5ccccc5-c5ccccc5C4)ccc1c23 |
| InChI | InChI=1S/C26H20N2O3S/c1-27-23-13-14-24(21-11-6-12-22(25(21)23)26(27)29)32(30,31)28-15-17-7-2-4-9-19(17)20-10-5-3-8-18(20)16-28/h2-14H,15-16H2,1H3 |
| InChIKey | PJNGZNFBLVCCSY-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 440.52 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one?
The IUPAC name of 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one (CID 166181776) is 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one.
What is the SMILES notation for 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one?
The canonical SMILES for 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one is CN1C(=O)c2cccc3c(S(=O)(=O)N4Cc5ccccc5-c5ccccc5C4)ccc1c23.
What is the InChIKey of 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one?
The InChIKey is PJNGZNFBLVCCSY-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H20N2O3S/c1-27-23-13-14-24(21-11-6-12-22(25(21)23)26(27)29)32(30,31)28-15-17-7-2-4-9-19(17)20-10-5-3-8-18(20)16-28/h2-14H,15-16H2,1H3.
What are the key properties of 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one?
6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one has a molecular weight of 440.52 g/mol, XLogP of 4.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5,7-dihydrobenzo[d][2]benzazepin-6-ylsulfonyl)-1-methylbenzo[cd]indol-2-one is sourced from PubChem (CID 166181776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).