C28H36N4O4 — CID 166184627
3-[2-[4-(adamantane-1-carbonyl)piperazin-1-yl]-2-oxoethyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 166184627) has the molecular formula C28H36N4O4 and a molecular weight of 492.62 g/mol. Its IUPAC name is 3-[2-[4-(adamantane-1-carbonyl)piperazin-1-yl]-2-oxoethyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-[4-(adamantane-1-carbonyl)piperazin-1-yl]-2-oxoethyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 166184627 |
| Molecular Formula | C28H36N4O4 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | 3-[2-[4-(adamantane-1-carbonyl)piperazin-1-yl]-2-oxoethyl]-5-methyl-5-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(C)NC(=O)N(CC(=O)N3CCN(C(=O)C45CC6CC(CC(C6)C4)C5)CC3)C2=O)cc1 |
| InChI | InChI=1S/C28H36N4O4/c1-18-3-5-22(6-4-18)27(2)24(34)32(26(36)29-27)17-23(33)30-7-9-31(10-8-30)25(35)28-14-19-11-20(15-28)13-21(12-19)16-28/h3-6,19-21H,7-17H2,1-2H3,(H,29,36) |
| InChIKey | UBDKHJLCBYIQHB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|