C24H24FN5O — CID 166185368
3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)propanamide (PubChem CID 166185368) has the molecular formula C24H24FN5O and a molecular weight of 417.49 g/mol. Its IUPAC name is 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)propanamide.
| Compound Name | 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)propanamide |
|---|---|
| PubChem CID | 166185368 |
| Molecular Formula | C24H24FN5O |
| Molecular Weight | 417.49 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 3-[2-(4-fluorophenyl)-1H-indol-3-yl]-N-(2-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[1,5-a]pyridin-6-yl)propanamide |
| SMILES | Cc1nc2n(n1)CC(NC(=O)CCc1c(-c3ccc(F)cc3)[nH]c3ccccc13)CC2 |
| InChI | InChI=1S/C24H24FN5O/c1-15-26-22-12-10-18(14-30(22)29-15)27-23(31)13-11-20-19-4-2-3-5-21(19)28-24(20)16-6-8-17(25)9-7-16/h2-9,18,28H,10-14H2,1H3,(H,27,31) |
| InChIKey | BNQQWVLEAJAZBU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 75.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |