C20H20FN3O5 — CID 166185491
N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-6-fluoro-4-oxochromene-2-carboxamide (PubChem CID 166185491) has the molecular formula C20H20FN3O5 and a molecular weight of 401.39 g/mol. Its IUPAC name is N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-6-fluoro-4-oxochromene-2-carboxamide.
| Compound Name | N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-6-fluoro-4-oxochromene-2-carboxamide |
|---|---|
| PubChem CID | 166185491 |
| Molecular Formula | C20H20FN3O5 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[3-(2,4-dioxo-1,3-diazaspiro[4.4]nonan-3-yl)propyl]-6-fluoro-4-oxochromene-2-carboxamide |
| SMILES | O=C(NCCCN1C(=O)NC2(CCCC2)C1=O)c1cc(=O)c2cc(F)ccc2o1 |
| InChI | InChI=1S/C20H20FN3O5/c21-12-4-5-15-13(10-12)14(25)11-16(29-15)17(26)22-8-3-9-24-18(27)20(23-19(24)28)6-1-2-7-20/h4-5,10-11H,1-3,6-9H2,(H,22,26)(H,23,28) |
| InChIKey | DPRLKJMQQYJCSW-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 108.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|