C31H24ClN5O2S3 — CID 166186116
2-[(4-chlorophenyl)sulfanylmethyl]-4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidine (PubChem CID 166186116) has the molecular formula C31H24ClN5O2S3 and a molecular weight of 630.22 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)sulfanylmethyl]-4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidine.
| Compound Name | 2-[(4-chlorophenyl)sulfanylmethyl]-4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 166186116 |
| Molecular Formula | C31H24ClN5O2S3 |
| Molecular Weight | 630.22 g/mol |
| Exact Mass | 629.08 |
| IUPAC Name | 2-[(4-chlorophenyl)sulfanylmethyl]-4-[[5-(2,3-dihydro-1,4-benzodioxin-3-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-5,6-dimethylthieno[2,3-d]pyrimidine |
| SMILES | Cc1sc2nc(CSc3ccc(Cl)cc3)nc(Sc3nnc(C4COc5ccccc5O4)n3-c3ccccc3)c2c1C |
| InChI | InChI=1S/C31H24ClN5O2S3/c1-18-19(2)41-29-27(18)30(34-26(33-29)17-40-22-14-12-20(32)13-15-22)42-31-36-35-28(37(31)21-8-4-3-5-9-21)25-16-38-23-10-6-7-11-24(23)39-25/h3-15,25H,16-17H2,1-2H3 |
| InChIKey | DUIOTROMIWPZAW-UHFFFAOYSA-N |
| XLogP | 8.50 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.22 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |