C27H28N8 — CID 166186696
N,N'-bis(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)propane-1,3-diamine (PubChem CID 166186696) has the molecular formula C27H28N8 and a molecular weight of 464.58 g/mol. Its IUPAC name is N,N'-bis(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)propane-1,3-diamine.
| Compound Name | N,N'-bis(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 166186696 |
| Molecular Formula | C27H28N8 |
| Molecular Weight | 464.58 g/mol |
| Exact Mass | 464.24 |
| IUPAC Name | N,N'-bis(2-pyridin-4-yl-6,7-dihydro-5H-cyclopenta[d]pyrimidin-4-yl)propane-1,3-diamine |
| SMILES | c1cc(-c2nc3c(c(NCCCNc4nc(-c5ccncc5)nc5c4CCC5)n2)CCC3)ccn1 |
| InChI | InChI=1S/C27H28N8/c1-4-20-22(6-1)32-24(18-8-14-28-15-9-18)34-26(20)30-12-3-13-31-27-21-5-2-7-23(21)33-25(35-27)19-10-16-29-17-11-19/h8-11,14-17H,1-7,12-13H2,(H,30,32,34)(H,31,33,35) |
| InChIKey | ZAGYMTOJQNYWLD-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 101.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.58 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|