About [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate
[3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate (PubChem CID 166186960) has the molecular formula C26H26N2O4
and a molecular weight of 430.50 g/mol. Its IUPAC name is [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate.
Molecular Properties
| Compound Name | [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate |
| PubChem CID | 166186960 |
| Molecular Formula | C26H26N2O4 |
| Molecular Weight | 430.50 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate |
| SMILES | COc1cccc(/C=C/C(=O)Nc2cccc(COC(=O)CC(C)c3ccncc3)c2)c1 |
| InChI | InChI=1S/C26H26N2O4/c1-19(22-11-13-27-14-12-22)15-26(30)32-18-21-6-3-7-23(16-21)28-25(29)10-9-20-5-4-8-24(17-20)31-2/h3-14,16-17,19H,15,18H2,1-2H3,(H,28,29)/b10-9+ |
| InChIKey | WEOOJUMNILISFH-MDZDMXLPSA-N |
| XLogP | 4.98 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 430.50 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate?
The IUPAC name of [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate (CID 166186960) is [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate.
What is the SMILES notation for [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate?
The canonical SMILES for [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate is COc1cccc(/C=C/C(=O)Nc2cccc(COC(=O)CC(C)c3ccncc3)c2)c1.
What is the InChIKey of [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate?
The InChIKey is WEOOJUMNILISFH-MDZDMXLPSA-N. The full InChI is InChI=1S/C26H26N2O4/c1-19(22-11-13-27-14-12-22)15-26(30)32-18-21-6-3-7-23(16-21)28-25(29)10-9-20-5-4-8-24(17-20)31-2/h3-14,16-17,19H,15,18H2,1-2H3,(H,28,29)/b10-9+.
What are the key properties of [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate?
[3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate has a molecular weight of 430.50 g/mol, XLogP of 4.98, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-[[(E)-3-(3-methoxyphenyl)prop-2-enoyl]amino]phenyl]methyl 3-pyridin-4-ylbutanoate is sourced from PubChem (CID 166186960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).