C32H40N4O5S2 — CID 166187201
1-[3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]ethanone (PubChem CID 166187201) has the molecular formula C32H40N4O5S2 and a molecular weight of 624.83 g/mol. Its IUPAC name is 1-[3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]ethanone.
| Compound Name | 1-[3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 166187201 |
| Molecular Formula | C32H40N4O5S2 |
| Molecular Weight | 624.83 g/mol |
| Exact Mass | 624.24 |
| IUPAC Name | 1-[3-(3,4-dimethoxyphenyl)-5-thiophen-2-yl-3,4-dihydropyrazol-2-yl]-2-[4-(2,3,4,5,6-pentamethylphenyl)sulfonylpiperazin-1-yl]ethanone |
| SMILES | COc1ccc(C2CC(c3cccs3)=NN2C(=O)CN2CCN(S(=O)(=O)c3c(C)c(C)c(C)c(C)c3C)CC2)cc1OC |
| InChI | InChI=1S/C32H40N4O5S2/c1-20-21(2)23(4)32(24(5)22(20)3)43(38,39)35-14-12-34(13-15-35)19-31(37)36-27(18-26(33-36)30-9-8-16-42-30)25-10-11-28(40-6)29(17-25)41-7/h8-11,16-17,27H,12-15,18-19H2,1-7H3 |
| InChIKey | SVPOMMWVUKVQGT-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 91.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.83 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |