C16H16FN5O3S — CID 16618846
N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide (PubChem CID 16618846) has the molecular formula C16H16FN5O3S and a molecular weight of 377.40 g/mol. Its IUPAC name is N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide.
| Compound Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 16618846 |
| Molecular Formula | C16H16FN5O3S |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.10 |
| IUPAC Name | N-(5-ethyl-1,3,4-thiadiazol-2-yl)-2-[4-(4-fluorophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetamide |
| SMILES | CCc1nnc(NC(=O)CN2C(=O)NC(C)(c3ccc(F)cc3)C2=O)s1 |
| InChI | InChI=1S/C16H16FN5O3S/c1-3-12-20-21-14(26-12)18-11(23)8-22-13(24)16(2,19-15(22)25)9-4-6-10(17)7-5-9/h4-7H,3,8H2,1-2H3,(H,19,25)(H,18,21,23) |
| InChIKey | QBBSDBCDFCFRLR-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|