C26H29N5O2 — CID 166189135
3-(3,4-dimethylphenyl)-N'-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)adamantane-1-carbohydrazide (PubChem CID 166189135) has the molecular formula C26H29N5O2 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-(3,4-dimethylphenyl)-N'-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)adamantane-1-carbohydrazide.
| Compound Name | 3-(3,4-dimethylphenyl)-N'-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 166189135 |
| Molecular Formula | C26H29N5O2 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.23 |
| IUPAC Name | 3-(3,4-dimethylphenyl)-N'-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)adamantane-1-carbohydrazide |
| SMILES | Cc1ccc(C23CC4CC(CC(C(=O)NNc5nc(-c6cccnc6)no5)(C4)C2)C3)cc1C |
| InChI | InChI=1S/C26H29N5O2/c1-16-5-6-21(8-17(16)2)25-10-18-9-19(11-25)13-26(12-18,15-25)23(32)29-30-24-28-22(31-33-24)20-4-3-7-27-14-20/h3-8,14,18-19H,9-13,15H2,1-2H3,(H,29,32)(H,28,30,31) |
| InChIKey | RJTXPVMUMMQFAV-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|