C25H31N3O4 — CID 166189563
tert-butyl (3S)-3-methyl-4-[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]piperazine-1-carboxylate (PubChem CID 166189563) has the molecular formula C25H31N3O4 and a molecular weight of 437.54 g/mol. Its IUPAC name is tert-butyl (3S)-3-methyl-4-[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-methyl-4-[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 166189563 |
| Molecular Formula | C25H31N3O4 |
| Molecular Weight | 437.54 g/mol |
| Exact Mass | 437.23 |
| IUPAC Name | tert-butyl (3S)-3-methyl-4-[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]piperazine-1-carboxylate |
| SMILES | C[C@H]1CN(C(=O)OC(C)(C)C)CCN1C(=O)/C=C/c1ccc(OCc2cccnc2)cc1 |
| InChI | InChI=1S/C25H31N3O4/c1-19-17-27(24(30)32-25(2,3)4)14-15-28(19)23(29)12-9-20-7-10-22(11-8-20)31-18-21-6-5-13-26-16-21/h5-13,16,19H,14-15,17-18H2,1-4H3/b12-9+/t19-/m0/s1 |
| InChIKey | RSPLIKVXQISJDA-DLENHJPASA-N |
| XLogP | 4.14 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.54 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|