C20H21N5O3 — CID 166190455
tert-butyl 3-[(2-methylpyrimidin-5-yl)carbamoyl]-1-phenylpyrazole-5-carboxylate (PubChem CID 166190455) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is tert-butyl 3-[(2-methylpyrimidin-5-yl)carbamoyl]-1-phenylpyrazole-5-carboxylate.
| Compound Name | tert-butyl 3-[(2-methylpyrimidin-5-yl)carbamoyl]-1-phenylpyrazole-5-carboxylate |
|---|---|
| PubChem CID | 166190455 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | tert-butyl 3-[(2-methylpyrimidin-5-yl)carbamoyl]-1-phenylpyrazole-5-carboxylate |
| SMILES | Cc1ncc(NC(=O)c2cc(C(=O)OC(C)(C)C)n(-c3ccccc3)n2)cn1 |
| InChI | InChI=1S/C20H21N5O3/c1-13-21-11-14(12-22-13)23-18(26)16-10-17(19(27)28-20(2,3)4)25(24-16)15-8-6-5-7-9-15/h5-12H,1-4H3,(H,23,26) |
| InChIKey | FAMANGPUSSRGFB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |