C14H20N4OS2 — CID 166191053
N-(5-octyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-5-carboxamide (PubChem CID 166191053) has the molecular formula C14H20N4OS2 and a molecular weight of 324.48 g/mol. Its IUPAC name is N-(5-octyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(5-octyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 166191053 |
| Molecular Formula | C14H20N4OS2 |
| Molecular Weight | 324.48 g/mol |
| Exact Mass | 324.11 |
| IUPAC Name | N-(5-octyl-1,3,4-thiadiazol-2-yl)-1,3-thiazole-5-carboxamide |
| SMILES | CCCCCCCCc1nnc(NC(=O)c2cncs2)s1 |
| InChI | InChI=1S/C14H20N4OS2/c1-2-3-4-5-6-7-8-12-17-18-14(21-12)16-13(19)11-9-15-10-20-11/h9-10H,2-8H2,1H3,(H,16,18,19) |
| InChIKey | SECMVBYMITYNMU-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|